C14H26N2 — CID 70588103
1-[(2Z)-3,7-dimethylocta-2,6-dienyl]piperazine (PubChem CID 70588103) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]piperazine.
| Compound Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]piperazine |
|---|---|
| PubChem CID | 70588103 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-[(2Z)-3,7-dimethylocta-2,6-dienyl]piperazine |
| SMILES | CC(C)=CCC/C(C)=C\CN1CCNCC1 |
| InChI | InChI=1S/C14H26N2/c1-13(2)5-4-6-14(3)7-10-16-11-8-15-9-12-16/h5,7,15H,4,6,8-12H2,1-3H3/b14-7- |
| InChIKey | DXYUBILCMWTMLB-AUWJEWJLSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|