C14H26N2 — CID 129253878
1-[(3E)-3-methylocta-3,7-dienyl]-1,4-diazepane (PubChem CID 129253878) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is 1-[(3E)-3-methylocta-3,7-dienyl]-1,4-diazepane.
| Compound Name | 1-[(3E)-3-methylocta-3,7-dienyl]-1,4-diazepane |
|---|---|
| PubChem CID | 129253878 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | 1-[(3E)-3-methylocta-3,7-dienyl]-1,4-diazepane |
| SMILES | C=CCC/C=C(\C)CCN1CCCNCC1 |
| InChI | InChI=1S/C14H26N2/c1-3-4-5-7-14(2)8-12-16-11-6-9-15-10-13-16/h3,7,15H,1,4-6,8-13H2,2H3/b14-7+ |
| InChIKey | HUSSJOHCUDQPAW-VGOFMYFVSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|