C8H17N3S — CID 82162725
3-(1,4-diazepan-1-yl)propanethioamide (PubChem CID 82162725) has the molecular formula C8H17N3S and a molecular weight of 187.31 g/mol. Its IUPAC name is 3-(1,4-diazepan-1-yl)propanethioamide.
| Compound Name | 3-(1,4-diazepan-1-yl)propanethioamide |
|---|---|
| PubChem CID | 82162725 |
| Molecular Formula | C8H17N3S |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 3-(1,4-diazepan-1-yl)propanethioamide |
| SMILES | NC(=S)CCN1CCCNCC1 |
| InChI | InChI=1S/C8H17N3S/c9-8(12)2-6-11-5-1-3-10-4-7-11/h10H,1-7H2,(H2,9,12) |
| InChIKey | NQJZSELXSSPVIW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|