C9H19N3S — CID 28745025
3-(4-methyl-1,4-diazepan-1-yl)propanethioamide (PubChem CID 28745025) has the molecular formula C9H19N3S and a molecular weight of 201.34 g/mol. Its IUPAC name is 3-(4-methyl-1,4-diazepan-1-yl)propanethioamide.
| Compound Name | 3-(4-methyl-1,4-diazepan-1-yl)propanethioamide |
|---|---|
| PubChem CID | 28745025 |
| Molecular Formula | C9H19N3S |
| Molecular Weight | 201.34 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-(4-methyl-1,4-diazepan-1-yl)propanethioamide |
| SMILES | CN1CCCN(CCC(N)=S)CC1 |
| InChI | InChI=1S/C9H19N3S/c1-11-4-2-5-12(8-7-11)6-3-9(10)13/h2-8H2,1H3,(H2,10,13) |
| InChIKey | JGECLXBWOFJLCF-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|