C10H20N2O — CID 28830199
4-(4-methyl-1,4-diazepan-1-yl)butan-2-one (PubChem CID 28830199) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-(4-methyl-1,4-diazepan-1-yl)butan-2-one.
| Compound Name | 4-(4-methyl-1,4-diazepan-1-yl)butan-2-one |
|---|---|
| PubChem CID | 28830199 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-(4-methyl-1,4-diazepan-1-yl)butan-2-one |
| SMILES | CC(=O)CCN1CCCN(C)CC1 |
| InChI | InChI=1S/C10H20N2O/c1-10(13)4-7-12-6-3-5-11(2)8-9-12/h3-9H2,1-2H3 |
| InChIKey | CHAUAKJWAKCHMD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |