C8H18N2OS — CID 84662880
1-(2-methylsulfinylethyl)-1,4-diazepane (PubChem CID 84662880) has the molecular formula C8H18N2OS and a molecular weight of 190.31 g/mol. Its IUPAC name is 1-(2-methylsulfinylethyl)-1,4-diazepane.
| Compound Name | 1-(2-methylsulfinylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 84662880 |
| Molecular Formula | C8H18N2OS |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-(2-methylsulfinylethyl)-1,4-diazepane |
| SMILES | CS(=O)CCN1CCCNCC1 |
| InChI | InChI=1S/C8H18N2OS/c1-12(11)8-7-10-5-2-3-9-4-6-10/h9H,2-8H2,1H3 |
| InChIKey | NDCMFJCBMGAGFX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |