C9H19N3O — CID 43162540
N-[2-(1,4-diazepan-1-yl)ethyl]acetamide (PubChem CID 43162540) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is N-[2-(1,4-diazepan-1-yl)ethyl]acetamide.
| Compound Name | N-[2-(1,4-diazepan-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 43162540 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | N-[2-(1,4-diazepan-1-yl)ethyl]acetamide |
| SMILES | CC(=O)NCCN1CCCNCC1 |
| InChI | InChI=1S/C9H19N3O/c1-9(13)11-5-8-12-6-2-3-10-4-7-12/h10H,2-8H2,1H3,(H,11,13) |
| InChIKey | GAOWNSDSZCMKBO-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |