C10H21N3O2 — CID 115736805
2-methoxy-N-(2-piperazin-1-ylethyl)propanamide (PubChem CID 115736805) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-methoxy-N-(2-piperazin-1-ylethyl)propanamide.
| Compound Name | 2-methoxy-N-(2-piperazin-1-ylethyl)propanamide |
|---|---|
| PubChem CID | 115736805 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-methoxy-N-(2-piperazin-1-ylethyl)propanamide |
| SMILES | COC(C)C(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C10H21N3O2/c1-9(15-2)10(14)12-5-8-13-6-3-11-4-7-13/h9,11H,3-8H2,1-2H3,(H,12,14) |
| InChIKey | ALXOTTDSOXBJMU-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |