C11H24ClN3O2 — CID 119446403
3-methoxy-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride (PubChem CID 119446403) has the molecular formula C11H24ClN3O2 and a molecular weight of 265.78 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride.
| Compound Name | 3-methoxy-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119446403 |
| Molecular Formula | C11H24ClN3O2 |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 3-methoxy-2-methyl-N-(2-piperazin-1-ylethyl)propanamide;hydrochloride |
| SMILES | COCC(C)C(=O)NCCN1CCNCC1.Cl |
| InChI | InChI=1S/C11H23N3O2.ClH/c1-10(9-16-2)11(15)13-5-8-14-6-3-12-4-7-14;/h10,12H,3-9H2,1-2H3,(H,13,15);1H |
| InChIKey | GGTKDBFEODREPG-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |