C14H28N6S2 — CID 3034507
N,N'-bis(2-piperazin-1-ylethyl)ethanedithioamide (PubChem CID 3034507) has the molecular formula C14H28N6S2 and a molecular weight of 344.55 g/mol. Its IUPAC name is N,N'-bis(2-piperazin-1-ylethyl)ethanedithioamide.
| Compound Name | N,N'-bis(2-piperazin-1-ylethyl)ethanedithioamide |
|---|---|
| PubChem CID | 3034507 |
| Molecular Formula | C14H28N6S2 |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N,N'-bis(2-piperazin-1-ylethyl)ethanedithioamide |
| SMILES | S=C(NCCN1CCNCC1)C(=S)NCCN1CCNCC1 |
| InChI | InChI=1S/C14H28N6S2/c21-13(17-5-11-19-7-1-15-2-8-19)14(22)18-6-12-20-9-3-16-4-10-20/h15-16H,1-12H2,(H,17,21)(H,18,22) |
| InChIKey | VHQRNZLMFMSUFY-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|