C8H15F3N4O — CID 108865910
1-(2-piperazin-1-ylethyl)-3-(trifluoromethyl)urea (PubChem CID 108865910) has the molecular formula C8H15F3N4O and a molecular weight of 240.23 g/mol. Its IUPAC name is 1-(2-piperazin-1-ylethyl)-3-(trifluoromethyl)urea.
| Compound Name | 1-(2-piperazin-1-ylethyl)-3-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 108865910 |
| Molecular Formula | C8H15F3N4O |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(2-piperazin-1-ylethyl)-3-(trifluoromethyl)urea |
| SMILES | O=C(NCCN1CCNCC1)NC(F)(F)F |
| InChI | InChI=1S/C8H15F3N4O/c9-8(10,11)14-7(16)13-3-6-15-4-1-12-2-5-15/h12H,1-6H2,(H2,13,14,16) |
| InChIKey | FZDCHTFDZSACJT-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|