C12H24N4O3 — CID 80540814
2-methyl-4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid (PubChem CID 80540814) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-methyl-4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid.
| Compound Name | 2-methyl-4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 80540814 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 2-methyl-4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid |
| SMILES | CC(CCNC(=O)NCCN1CCNCC1)C(=O)O |
| InChI | InChI=1S/C12H24N4O3/c1-10(11(17)18)2-3-14-12(19)15-6-9-16-7-4-13-5-8-16/h10,13H,2-9H2,1H3,(H,17,18)(H2,14,15,19) |
| InChIKey | PBOWBHAAUDQAGL-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |