C13H26N4O3 — CID 61408451
3-methyl-2-(2-piperazin-1-ylethylcarbamoylamino)pentanoic acid (PubChem CID 61408451) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3-methyl-2-(2-piperazin-1-ylethylcarbamoylamino)pentanoic acid.
| Compound Name | 3-methyl-2-(2-piperazin-1-ylethylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 61408451 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 3-methyl-2-(2-piperazin-1-ylethylcarbamoylamino)pentanoic acid |
| SMILES | CCC(C)C(NC(=O)NCCN1CCNCC1)C(=O)O |
| InChI | InChI=1S/C13H26N4O3/c1-3-10(2)11(12(18)19)16-13(20)15-6-9-17-7-4-14-5-8-17/h10-11,14H,3-9H2,1-2H3,(H,18,19)(H2,15,16,20) |
| InChIKey | JALSGECJWUAYCI-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |