C10H20N4O4 — CID 83112549
(2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-3-methylpentanoic acid (PubChem CID 83112549) has the molecular formula C10H20N4O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 83112549 |
| Molecular Formula | C10H20N4O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (2S)-2-[2-(carbamoylamino)ethylcarbamoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)[C@H](NC(=O)NCCNC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H20N4O4/c1-3-6(2)7(8(15)16)14-10(18)13-5-4-12-9(11)17/h6-7H,3-5H2,1-2H3,(H,15,16)(H3,11,12,17)(H2,13,14,18)/t6?,7-/m0/s1 |
| InChIKey | USMSVNIVJAXEFP-MLWJPKLSSA-N |
| XLogP | -0.55 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|