C11H20N2O5 — CID 146684677
(2S,3S)-2-(3-carboxypropylcarbamoylamino)-3-methylpentanoic acid (PubChem CID 146684677) has the molecular formula C11H20N2O5 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S,3S)-2-(3-carboxypropylcarbamoylamino)-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-(3-carboxypropylcarbamoylamino)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 146684677 |
| Molecular Formula | C11H20N2O5 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S,3S)-2-(3-carboxypropylcarbamoylamino)-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)NCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5/c1-3-7(2)9(10(16)17)13-11(18)12-6-4-5-8(14)15/h7,9H,3-6H2,1-2H3,(H,14,15)(H,16,17)(H2,12,13,18)/t7-,9-/m0/s1 |
| InChIKey | WVJSFRYGZMBJOD-CBAPKCEASA-N |
| XLogP | 0.65 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|