C14H27N3O4 — CID 4221669
methyl 3-methyl-2-(2-morpholin-4-ylethylcarbamoylamino)pentanoate (PubChem CID 4221669) has the molecular formula C14H27N3O4 and a molecular weight of 301.39 g/mol. Its IUPAC name is methyl 3-methyl-2-(2-morpholin-4-ylethylcarbamoylamino)pentanoate.
| Compound Name | methyl 3-methyl-2-(2-morpholin-4-ylethylcarbamoylamino)pentanoate |
|---|---|
| PubChem CID | 4221669 |
| Molecular Formula | C14H27N3O4 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | methyl 3-methyl-2-(2-morpholin-4-ylethylcarbamoylamino)pentanoate |
| SMILES | CCC(C)C(NC(=O)NCCN1CCOCC1)C(=O)OC |
| InChI | InChI=1S/C14H27N3O4/c1-4-11(2)12(13(18)20-3)16-14(19)15-5-6-17-7-9-21-10-8-17/h11-12H,4-10H2,1-3H3,(H2,15,16,19) |
| InChIKey | NHINASDRTMXAOA-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |