C15H29N3O4 — CID 5027932
methyl 4-methyl-2-(3-morpholin-4-ylpropylcarbamoylamino)pentanoate (PubChem CID 5027932) has the molecular formula C15H29N3O4 and a molecular weight of 315.41 g/mol. Its IUPAC name is methyl 4-methyl-2-(3-morpholin-4-ylpropylcarbamoylamino)pentanoate.
| Compound Name | methyl 4-methyl-2-(3-morpholin-4-ylpropylcarbamoylamino)pentanoate |
|---|---|
| PubChem CID | 5027932 |
| Molecular Formula | C15H29N3O4 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | methyl 4-methyl-2-(3-morpholin-4-ylpropylcarbamoylamino)pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)NCCCN1CCOCC1 |
| InChI | InChI=1S/C15H29N3O4/c1-12(2)11-13(14(19)21-3)17-15(20)16-5-4-6-18-7-9-22-10-8-18/h12-13H,4-11H2,1-3H3,(H2,16,17,20) |
| InChIKey | ZABXKQKQSUCEGF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|