C20H39N3O4 — CID 177124025
2-(3-morpholin-4-ylpropylcarbamoylamino)ethyl 3,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 177124025) has the molecular formula C20H39N3O4 and a molecular weight of 385.55 g/mol. Its IUPAC name is 2-(3-morpholin-4-ylpropylcarbamoylamino)ethyl 3,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 2-(3-morpholin-4-ylpropylcarbamoylamino)ethyl 3,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 177124025 |
| Molecular Formula | C20H39N3O4 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.29 |
| IUPAC Name | 2-(3-morpholin-4-ylpropylcarbamoylamino)ethyl 3,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C)C(C(=O)OCCNC(=O)NCCCN1CCOCC1)C(C)C |
| InChI | InChI=1S/C20H39N3O4/c1-15(2)17(5)18(16(3)4)19(24)27-12-8-22-20(25)21-7-6-9-23-10-13-26-14-11-23/h15-18H,6-14H2,1-5H3,(H2,21,22,25) |
| InChIKey | IWRKYQMKDJFTLH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|