C11H24N2O3 — CID 154661230
butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen (PubChem CID 154661230) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen.
| Compound Name | butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen |
|---|---|
| PubChem CID | 154661230 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen |
| SMILES | CCC(C)OC(=O)NCCN1CCOCC1.[H][H] |
| InChI | InChI=1S/C11H22N2O3.H2/c1-3-10(2)16-11(14)12-4-5-13-6-8-15-9-7-13;/h10H,3-9H2,1-2H3,(H,12,14);1H |
| InChIKey | KIZHYJSVBXWVSC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |