butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen

C11H24N2O3 — CID 154661230

IUPACbutan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen
SMILESCCC(C)OC(=O)NCCN1CCOCC1.[H][H]
InChIInChI=1S/C11H22N2O3.H2/c1-3-10(2)16-11(14)12-4-5-13-6-8-15-9-7-13;/h10H,3-9H2,1-2H3,(H,12,14);1H
InChIKeyKIZHYJSVBXWVSC-UHFFFAOYSA-N
MW232.32 g/mol
LogP1.09
Rot. Bonds5

About butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen

butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen (PubChem CID 154661230) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen.

Molecular Properties

Compound Namebutan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen
PubChem CID154661230
Molecular FormulaC11H24N2O3
Molecular Weight232.32 g/mol
Exact Mass232.18
IUPAC Namebutan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen
SMILESCCC(C)OC(=O)NCCN1CCOCC1.[H][H]
InChIInChI=1S/C11H22N2O3.H2/c1-3-10(2)16-11(14)12-4-5-13-6-8-15-9-7-13;/h10H,3-9H2,1-2H3,(H,12,14);1H
InChIKeyKIZHYJSVBXWVSC-UHFFFAOYSA-N
XLogP1.09
TPSA50.80 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.32
LogP ≤ 51.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen?
The IUPAC name of butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen (CID 154661230) is butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen.
What is the SMILES notation for butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen?
The canonical SMILES for butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen is CCC(C)OC(=O)NCCN1CCOCC1.[H][H].
What is the InChIKey of butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen?
The InChIKey is KIZHYJSVBXWVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3.H2/c1-3-10(2)16-11(14)12-4-5-13-6-8-15-9-7-13;/h10H,3-9H2,1-2H3,(H,12,14);1H.
What are the key properties of butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen?
butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen has a molecular weight of 232.32 g/mol, XLogP of 1.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl N-(2-morpholin-4-ylethyl)carbamate;molecular hydrogen is sourced from PubChem (CID 154661230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).