C11H22N4O3 — CID 61408408
4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid (PubChem CID 61408408) has the molecular formula C11H22N4O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid.
| Compound Name | 4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 61408408 |
| Molecular Formula | C11H22N4O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-(2-piperazin-1-ylethylcarbamoylamino)butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCCN1CCNCC1 |
| InChI | InChI=1S/C11H22N4O3/c16-10(17)2-1-3-13-11(18)14-6-9-15-7-4-12-5-8-15/h12H,1-9H2,(H,16,17)(H2,13,14,18) |
| InChIKey | VLYOJKSZOSTXIV-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|