About 6-piperazin-1-ylhexanoic acid
6-piperazin-1-ylhexanoic acid (PubChem CID 54010280) has the molecular formula C10H20N2O2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 6-piperazin-1-ylhexanoic acid.
Molecular Properties
| Compound Name | 6-piperazin-1-ylhexanoic acid |
| PubChem CID | 54010280 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | 6-piperazin-1-ylhexanoic acid |
| SMILES | O=C(O)CCCCCN1CCNCC1 |
| InChI | InChI=1S/C10H20N2O2/c13-10(14)4-2-1-3-7-12-8-5-11-6-9-12/h11H,1-9H2,(H,13,14) |
| InChIKey | MPLRMSCULRDKFQ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-piperazin-1-ylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-ylhexanoic acid?
The IUPAC name of 6-piperazin-1-ylhexanoic acid (CID 54010280) is 6-piperazin-1-ylhexanoic acid.
What is the SMILES notation for 6-piperazin-1-ylhexanoic acid?
The canonical SMILES for 6-piperazin-1-ylhexanoic acid is O=C(O)CCCCCN1CCNCC1.
What is the InChIKey of 6-piperazin-1-ylhexanoic acid?
The InChIKey is MPLRMSCULRDKFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2/c13-10(14)4-2-1-3-7-12-8-5-11-6-9-12/h11H,1-9H2,(H,13,14).
What are the key properties of 6-piperazin-1-ylhexanoic acid?
6-piperazin-1-ylhexanoic acid has a molecular weight of 200.28 g/mol, XLogP of 0.54, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-ylhexanoic acid is sourced from PubChem (CID 54010280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).