C16H33N3O4 — CID 168837908
2-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]propanamide (PubChem CID 168837908) has the molecular formula C16H33N3O4 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 168837908 |
| Molecular Formula | C16H33N3O4 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-(2-piperazin-1-ylethoxy)ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)C(=O)NCCOCCOCCOCCN1CCNCC1 |
| InChI | InChI=1S/C16H33N3O4/c1-15(2)16(20)18-5-9-21-11-13-23-14-12-22-10-8-19-6-3-17-4-7-19/h15,17H,3-14H2,1-2H3,(H,18,20) |
| InChIKey | OKCRCQMUZDDYJE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|