C20H41N3O4 — CID 138728006
2-methyl-N-[2-[2-[2-[2-[4-(propan-2-ylamino)piperidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 138728006) has the molecular formula C20H41N3O4 and a molecular weight of 387.57 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-[2-[2-[4-(propan-2-ylamino)piperidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | 2-methyl-N-[2-[2-[2-[2-[4-(propan-2-ylamino)piperidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 138728006 |
| Molecular Formula | C20H41N3O4 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | 2-methyl-N-[2-[2-[2-[2-[4-(propan-2-ylamino)piperidin-1-yl]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(C)NC1CCN(CCOCCOCCOCCNC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C20H41N3O4/c1-17(2)20(24)21-7-11-25-13-15-27-16-14-26-12-10-23-8-5-19(6-9-23)22-18(3)4/h17-19,22H,5-16H2,1-4H3,(H,21,24) |
| InChIKey | FMDBSBTZOOPDKM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|