C16H39N3O2 — CID 171539223
N-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethyl]-2-methylbutanamide;ethane;molecular hydrogen (PubChem CID 171539223) has the molecular formula C16H39N3O2 and a molecular weight of 305.51 g/mol. Its IUPAC name is N-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethyl]-2-methylbutanamide;ethane;molecular hydrogen.
| Compound Name | N-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethyl]-2-methylbutanamide;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 171539223 |
| Molecular Formula | C16H39N3O2 |
| Molecular Weight | 305.51 g/mol |
| Exact Mass | 305.30 |
| IUPAC Name | N-[2-[2-(4-aminopiperidin-1-yl)ethoxy]ethyl]-2-methylbutanamide;ethane;molecular hydrogen |
| SMILES | CC.CCC(C)C(=O)NCCOCCN1CCC(N)CC1.[H][H].[H][H] |
| InChI | InChI=1S/C14H29N3O2.C2H6.2H2/c1-3-12(2)14(18)16-6-10-19-11-9-17-7-4-13(15)5-8-17;1-2;;/h12-13H,3-11,15H2,1-2H3,(H,16,18);1-2H3;2*1H |
| InChIKey | FWLKNTQIFAUYMP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|