C16H32N4O2 — CID 166586186
4-amino-2-methyl-N-[2-(2-piperazin-1-ylethoxy)ethyl]cyclohexane-1-carboxamide (PubChem CID 166586186) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is 4-amino-2-methyl-N-[2-(2-piperazin-1-ylethoxy)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-amino-2-methyl-N-[2-(2-piperazin-1-ylethoxy)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 166586186 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | 4-amino-2-methyl-N-[2-(2-piperazin-1-ylethoxy)ethyl]cyclohexane-1-carboxamide |
| SMILES | CC1CC(N)CCC1C(=O)NCCOCCN1CCNCC1 |
| InChI | InChI=1S/C16H32N4O2/c1-13-12-14(17)2-3-15(13)16(21)19-6-10-22-11-9-20-7-4-18-5-8-20/h13-15,18H,2-12,17H2,1H3,(H,19,21) |
| InChIKey | NLZQLEVVENOUMB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|