C22H40N6O — CID 70834106
N-[2-[[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methylamino]ethyl]acetamide (PubChem CID 70834106) has the molecular formula C22H40N6O and a molecular weight of 404.60 g/mol. Its IUPAC name is N-[2-[[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 70834106 |
| Molecular Formula | C22H40N6O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | N-[2-[[4-(1,4,8,11-tetrazacyclotetradec-1-ylmethyl)phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1ccc(CN2CCCNCCNCCCNCC2)cc1 |
| InChI | InChI=1S/C22H40N6O/c1-20(29)27-14-13-26-18-21-4-6-22(7-5-21)19-28-16-3-10-24-12-11-23-8-2-9-25-15-17-28/h4-7,23-26H,2-3,8-19H2,1H3,(H,27,29) |
| InChIKey | QJCRJVGKGHSULY-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|