C28H55N5O3Si — CID 22619207
N-[[4-(1,4,8,12-tetrazacyclopentadec-1-ylmethyl)phenyl]methyl]-3-triethoxysilylpropan-1-amine (PubChem CID 22619207) has the molecular formula C28H55N5O3Si and a molecular weight of 537.87 g/mol. Its IUPAC name is N-[[4-(1,4,8,12-tetrazacyclopentadec-1-ylmethyl)phenyl]methyl]-3-triethoxysilylpropan-1-amine.
| Compound Name | N-[[4-(1,4,8,12-tetrazacyclopentadec-1-ylmethyl)phenyl]methyl]-3-triethoxysilylpropan-1-amine |
|---|---|
| PubChem CID | 22619207 |
| Molecular Formula | C28H55N5O3Si |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 537.41 |
| IUPAC Name | N-[[4-(1,4,8,12-tetrazacyclopentadec-1-ylmethyl)phenyl]methyl]-3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCNCc1ccc(CN2CCCNCCCNCCCNCC2)cc1)(OCC)OCC |
| InChI | InChI=1S/C28H55N5O3Si/c1-4-34-37(35-5-2,36-6-3)24-10-20-32-25-27-11-13-28(14-12-27)26-33-22-9-19-30-17-7-15-29-16-8-18-31-21-23-33/h11-14,29-32H,4-10,15-26H2,1-3H3 |
| InChIKey | GWPWUEIVLPEEJI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 79.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|