C7H16N2O2S — CID 84664343
2-(1,4-diazepan-1-yl)ethanesulfinic acid (PubChem CID 84664343) has the molecular formula C7H16N2O2S and a molecular weight of 192.28 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)ethanesulfinic acid.
| Compound Name | 2-(1,4-diazepan-1-yl)ethanesulfinic acid |
|---|---|
| PubChem CID | 84664343 |
| Molecular Formula | C7H16N2O2S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)ethanesulfinic acid |
| SMILES | O=S(O)CCN1CCCNCC1 |
| InChI | InChI=1S/C7H16N2O2S/c10-12(11)7-6-9-4-1-2-8-3-5-9/h8H,1-7H2,(H,10,11) |
| InChIKey | BDXXCYMFVCQYJK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|