C9H15F3N2O2 — CID 91047530
2-(1,4-diazepan-1-yl)ethyl 2,2,2-trifluoroacetate (PubChem CID 91047530) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-(1,4-diazepan-1-yl)ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91047530 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)ethyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCCN1CCCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2/c10-9(11,12)8(15)16-7-6-14-4-1-2-13-3-5-14/h13H,1-7H2 |
| InChIKey | WOEKFFOHXXDTHK-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |