About 2-piperazin-1-ylethyl 2-iodopropanoate
2-piperazin-1-ylethyl 2-iodopropanoate (PubChem CID 162508644) has the molecular formula C9H17IN2O2
and a molecular weight of 312.15 g/mol. Its IUPAC name is 2-piperazin-1-ylethyl 2-iodopropanoate.
Molecular Properties
| Compound Name | 2-piperazin-1-ylethyl 2-iodopropanoate |
| PubChem CID | 162508644 |
| Molecular Formula | C9H17IN2O2 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 2-piperazin-1-ylethyl 2-iodopropanoate |
| SMILES | CC(I)C(=O)OCCN1CCNCC1 |
| InChI | InChI=1S/C9H17IN2O2/c1-8(10)9(13)14-7-6-12-4-2-11-3-5-12/h8,11H,2-7H2,1H3 |
| InChIKey | BAPQHVGCXQYGIA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-piperazin-1-ylethyl 2-iodopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylethyl 2-iodopropanoate?
The IUPAC name of 2-piperazin-1-ylethyl 2-iodopropanoate (CID 162508644) is 2-piperazin-1-ylethyl 2-iodopropanoate.
What is the SMILES notation for 2-piperazin-1-ylethyl 2-iodopropanoate?
The canonical SMILES for 2-piperazin-1-ylethyl 2-iodopropanoate is CC(I)C(=O)OCCN1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylethyl 2-iodopropanoate?
The InChIKey is BAPQHVGCXQYGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17IN2O2/c1-8(10)9(13)14-7-6-12-4-2-11-3-5-12/h8,11H,2-7H2,1H3.
What are the key properties of 2-piperazin-1-ylethyl 2-iodopropanoate?
2-piperazin-1-ylethyl 2-iodopropanoate has a molecular weight of 312.15 g/mol, XLogP of 0.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylethyl 2-iodopropanoate is sourced from PubChem (CID 162508644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).