C22H34N2O9S2 — CID 71300829
methanesulfonic acid;2-piperazin-1-ylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 71300829) has the molecular formula C22H34N2O9S2 and a molecular weight of 534.65 g/mol. Its IUPAC name is methanesulfonic acid;2-piperazin-1-ylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | methanesulfonic acid;2-piperazin-1-ylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 71300829 |
| Molecular Formula | C22H34N2O9S2 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | methanesulfonic acid;2-piperazin-1-ylethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)OCCN3CCNCC3)ccc2c1.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C20H26N2O3.2CH4O3S/c1-15(20(23)25-12-11-22-9-7-21-8-10-22)16-3-4-18-14-19(24-2)6-5-17(18)13-16;2*1-5(2,3)4/h3-6,13-15,21H,7-12H2,1-2H3;2*1H3,(H,2,3,4)/t15-;;/m0../s1 |
| InChIKey | HXLUVFRNDDBYJD-CKUXDGONSA-N |
| XLogP | 1.41 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|