C18H22O6S — CID 89099658
3-methylsulfonyloxypropyl 2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 89099658) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is 3-methylsulfonyloxypropyl 2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | 3-methylsulfonyloxypropyl 2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 89099658 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 3-methylsulfonyloxypropyl 2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | COc1ccc2cc(C(C)C(=O)OCCCOS(C)(=O)=O)ccc2c1 |
| InChI | InChI=1S/C18H22O6S/c1-13(18(19)23-9-4-10-24-25(3,20)21)14-5-6-16-12-17(22-2)8-7-15(16)11-14/h5-8,11-13H,4,9-10H2,1-3H3 |
| InChIKey | CWGOLZHYOQGPHY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|