About 2-piperazin-1-ylethyl carbonochloridate
2-piperazin-1-ylethyl carbonochloridate (PubChem CID 19711096) has the molecular formula C7H13ClN2O2
and a molecular weight of 192.65 g/mol. Its IUPAC name is 2-piperazin-1-ylethyl carbonochloridate.
Molecular Properties
| Compound Name | 2-piperazin-1-ylethyl carbonochloridate |
| PubChem CID | 19711096 |
| Molecular Formula | C7H13ClN2O2 |
| Molecular Weight | 192.65 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 2-piperazin-1-ylethyl carbonochloridate |
| SMILES | O=C(Cl)OCCN1CCNCC1 |
| InChI | InChI=1S/C7H13ClN2O2/c8-7(11)12-6-5-10-3-1-9-2-4-10/h9H,1-6H2 |
| InChIKey | SHTQWQLLJNMXPU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.65 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperazin-1-ylethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperazin-1-ylethyl carbonochloridate?
The IUPAC name of 2-piperazin-1-ylethyl carbonochloridate (CID 19711096) is 2-piperazin-1-ylethyl carbonochloridate.
What is the SMILES notation for 2-piperazin-1-ylethyl carbonochloridate?
The canonical SMILES for 2-piperazin-1-ylethyl carbonochloridate is O=C(Cl)OCCN1CCNCC1.
What is the InChIKey of 2-piperazin-1-ylethyl carbonochloridate?
The InChIKey is SHTQWQLLJNMXPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClN2O2/c8-7(11)12-6-5-10-3-1-9-2-4-10/h9H,1-6H2.
What are the key properties of 2-piperazin-1-ylethyl carbonochloridate?
2-piperazin-1-ylethyl carbonochloridate has a molecular weight of 192.65 g/mol, XLogP of 0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperazin-1-ylethyl carbonochloridate is sourced from PubChem (CID 19711096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).