C12H22N2O — CID 116565572
1-(1,4-diazepan-1-yl)hept-6-en-2-one (PubChem CID 116565572) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-(1,4-diazepan-1-yl)hept-6-en-2-one.
| Compound Name | 1-(1,4-diazepan-1-yl)hept-6-en-2-one |
|---|---|
| PubChem CID | 116565572 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 1-(1,4-diazepan-1-yl)hept-6-en-2-one |
| SMILES | C=CCCCC(=O)CN1CCCNCC1 |
| InChI | InChI=1S/C12H22N2O/c1-2-3-4-6-12(15)11-14-9-5-7-13-8-10-14/h2,13H,1,3-11H2 |
| InChIKey | QJOIBBIBMYIVPW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|