C12H25FN4O — CID 102177637
2-(1,4,8,11-tetrazacyclotetradec-1-yl)acetyl fluoride (PubChem CID 102177637) has the molecular formula C12H25FN4O and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-(1,4,8,11-tetrazacyclotetradec-1-yl)acetyl fluoride.
| Compound Name | 2-(1,4,8,11-tetrazacyclotetradec-1-yl)acetyl fluoride |
|---|---|
| PubChem CID | 102177637 |
| Molecular Formula | C12H25FN4O |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 2-(1,4,8,11-tetrazacyclotetradec-1-yl)acetyl fluoride |
| SMILES | O=C(F)CN1CCCNCCNCCCNCC1 |
| InChI | InChI=1S/C12H25FN4O/c13-12(18)11-17-9-2-5-15-7-6-14-3-1-4-16-8-10-17/h14-16H,1-11H2 |
| InChIKey | VCYPVDBMGYABEY-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|