About CID 140659696
CID 140659696 (PubChem CID 140659696) has the molecular formula C7H13N2O
and a molecular weight of 141.19 g/mol.
Molecular Properties
| Compound Name | CID 140659696 |
| PubChem CID | 140659696 |
| Molecular Formula | C7H13N2O |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | — |
| SMILES | [CH2]C(=O)CN1CCNCC1 |
| InChI | InChI=1S/C7H13N2O/c1-7(10)6-9-4-2-8-3-5-9/h8H,1-6H2 |
| InChIKey | VRUVZGDSMCQXRE-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 140659696 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140659696?
The IUPAC name of CID 140659696 (CID 140659696) is not available.
What is the SMILES notation for CID 140659696?
The canonical SMILES for CID 140659696 is [CH2]C(=O)CN1CCNCC1.
What is the InChIKey of CID 140659696?
The InChIKey is VRUVZGDSMCQXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N2O/c1-7(10)6-9-4-2-8-3-5-9/h8H,1-6H2.
What are the key properties of CID 140659696?
CID 140659696 has a molecular weight of 141.19 g/mol, XLogP of -0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140659696 is sourced from PubChem (CID 140659696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).