About cesium 2-piperazin-1-ylacetate
cesium 2-piperazin-1-ylacetate (PubChem CID 143618324) has the molecular formula C6H11CsN2O2
and a molecular weight of 276.07 g/mol. Its IUPAC name is cesium 2-piperazin-1-ylacetate.
Molecular Properties
| Compound Name | cesium 2-piperazin-1-ylacetate |
| PubChem CID | 143618324 |
| Molecular Formula | C6H11CsN2O2 |
| Molecular Weight | 276.07 g/mol |
| Exact Mass | 275.99 |
| IUPAC Name | cesium 2-piperazin-1-ylacetate |
| SMILES | O=C([O-])CN1CCNCC1.[Cs+] |
| InChI | InChI=1S/C6H12N2O2.Cs/c9-6(10)5-8-3-1-7-2-4-8;/h7H,1-5H2,(H,9,10);/q;+1/p-1 |
| InChIKey | IFDFZMWNAPJRMO-UHFFFAOYSA-M |
| XLogP | -5.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.07 |
| LogP ≤ 5 | -5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cesium 2-piperazin-1-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 2-piperazin-1-ylacetate?
The IUPAC name of cesium 2-piperazin-1-ylacetate (CID 143618324) is cesium 2-piperazin-1-ylacetate.
What is the SMILES notation for cesium 2-piperazin-1-ylacetate?
The canonical SMILES for cesium 2-piperazin-1-ylacetate is O=C([O-])CN1CCNCC1.[Cs+].
What is the InChIKey of cesium 2-piperazin-1-ylacetate?
The InChIKey is IFDFZMWNAPJRMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12N2O2.Cs/c9-6(10)5-8-3-1-7-2-4-8;/h7H,1-5H2,(H,9,10);/q;+1/p-1.
What are the key properties of cesium 2-piperazin-1-ylacetate?
cesium 2-piperazin-1-ylacetate has a molecular weight of 276.07 g/mol, XLogP of -5.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2-piperazin-1-ylacetate is sourced from PubChem (CID 143618324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).