C7H14N2O — CID 58823346
1-((415N)1,4-diazinan-1-yl)propan-2-one (PubChem CID 58823346) has the molecular formula C7H14N2O and a molecular weight of 143.20 g/mol. Its IUPAC name is 1-((415N)1,4-diazinan-1-yl)propan-2-one.
| Compound Name | 1-((415N)1,4-diazinan-1-yl)propan-2-one |
|---|---|
| PubChem CID | 58823346 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 1-((415N)1,4-diazinan-1-yl)propan-2-one |
| SMILES | CC(=O)CN1CC[15NH]CC1 |
| InChI | InChI=1S/C7H14N2O/c1-7(10)6-9-4-2-8-3-5-9/h8H,2-6H2,1H3/i8+1 |
| InChIKey | LWAQMFOMLLTHKZ-VJJZLTLGSA-N |
| XLogP | -0.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |