C15H29N3O3 — CID 118026423
tert-butyl 2-[4-(2-oxopropyl)-1,4,7-triazonan-1-yl]acetate (PubChem CID 118026423) has the molecular formula C15H29N3O3 and a molecular weight of 299.41 g/mol. Its IUPAC name is tert-butyl 2-[4-(2-oxopropyl)-1,4,7-triazonan-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-(2-oxopropyl)-1,4,7-triazonan-1-yl]acetate |
|---|---|
| PubChem CID | 118026423 |
| Molecular Formula | C15H29N3O3 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | tert-butyl 2-[4-(2-oxopropyl)-1,4,7-triazonan-1-yl]acetate |
| SMILES | CC(=O)CN1CCNCCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29N3O3/c1-13(19)11-17-7-5-16-6-8-18(10-9-17)12-14(20)21-15(2,3)4/h16H,5-12H2,1-4H3 |
| InChIKey | LYQBMPJOCNJAKQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |