C11H21N3O3 — CID 11195897
tert-butyl 2-(4-carbamoylpiperazin-1-yl)acetate (PubChem CID 11195897) has the molecular formula C11H21N3O3 and a molecular weight of 243.31 g/mol. Its IUPAC name is tert-butyl 2-(4-carbamoylpiperazin-1-yl)acetate.
| Compound Name | tert-butyl 2-(4-carbamoylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 11195897 |
| Molecular Formula | C11H21N3O3 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | tert-butyl 2-(4-carbamoylpiperazin-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(C(N)=O)CC1 |
| InChI | InChI=1S/C11H21N3O3/c1-11(2,3)17-9(15)8-13-4-6-14(7-5-13)10(12)16/h4-8H2,1-3H3,(H2,12,16) |
| InChIKey | SBCWOUFFGWAPOD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |