C38H74N4O10 — CID 156838383
tert-butyl 2-[7,13,16-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,10-dioxa-4,7,13,16-tetrazacyclooctadec-4-yl]acetate;ethane (PubChem CID 156838383) has the molecular formula C38H74N4O10 and a molecular weight of 747.03 g/mol. Its IUPAC name is tert-butyl 2-[7,13,16-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,10-dioxa-4,7,13,16-tetrazacyclooctadec-4-yl]acetate;ethane.
| Compound Name | tert-butyl 2-[7,13,16-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,10-dioxa-4,7,13,16-tetrazacyclooctadec-4-yl]acetate;ethane |
|---|---|
| PubChem CID | 156838383 |
| Molecular Formula | C38H74N4O10 |
| Molecular Weight | 747.03 g/mol |
| Exact Mass | 746.54 |
| IUPAC Name | tert-butyl 2-[7,13,16-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,10-dioxa-4,7,13,16-tetrazacyclooctadec-4-yl]acetate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)CN1CCOCCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCOCCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C36H68N4O10.C2H6/c1-33(2,3)47-29(41)25-37-13-14-38(26-30(42)48-34(4,5)6)18-23-46-24-20-40(28-32(44)50-36(10,11)12)16-15-39(19-22-45-21-17-37)27-31(43)49-35(7,8)9;1-2/h13-28H2,1-12H3;1-2H3 |
| InChIKey | KRBTYZCMZGZKLM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 136.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.03 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|