C27H49KN4O6S2 — CID 102233269
potassium 4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carbodithioate (PubChem CID 102233269) has the molecular formula C27H49KN4O6S2 and a molecular weight of 628.94 g/mol. Its IUPAC name is potassium 4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carbodithioate.
| Compound Name | potassium 4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carbodithioate |
|---|---|
| PubChem CID | 102233269 |
| Molecular Formula | C27H49KN4O6S2 |
| Molecular Weight | 628.94 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | potassium 4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododecane-1-carbodithioate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN(C(=S)[S-])CCN(CC(=O)OC(C)(C)C)CC1.[K+] |
| InChI | InChI=1S/C27H50N4O6S2.K/c1-25(2,3)35-21(32)18-28-10-12-29(19-22(33)36-26(4,5)6)14-16-31(24(38)39)17-15-30(13-11-28)20-23(34)37-27(7,8)9;/h10-20H2,1-9H3,(H,38,39);/q;+1/p-1 |
| InChIKey | FHGAPEWYGIIEJE-UHFFFAOYSA-M |
| XLogP | -0.93 |
| TPSA | 91.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.94 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|