C26H49N4O6+ — CID 59865579
tert-butyl 7-methylidene-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododecane-1-carboxylate (PubChem CID 59865579) has the molecular formula C26H49N4O6+ and a molecular weight of 513.70 g/mol. Its IUPAC name is tert-butyl 7-methylidene-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododecane-1-carboxylate.
| Compound Name | tert-butyl 7-methylidene-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododecane-1-carboxylate |
|---|---|
| PubChem CID | 59865579 |
| Molecular Formula | C26H49N4O6+ |
| Molecular Weight | 513.70 g/mol |
| Exact Mass | 513.36 |
| IUPAC Name | tert-butyl 7-methylidene-4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,10-triaza-7-azoniacyclododecane-1-carboxylate |
| SMILES | C=[N+]1CCN(CC(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H49N4O6/c1-24(2,3)34-21(31)19-28-13-11-27(10)12-14-29(20-22(32)35-25(4,5)6)16-18-30(17-15-28)23(33)36-26(7,8)9/h10-20H2,1-9H3/q+1 |
| InChIKey | JSTZIVYTEWJWRZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.70 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|