C30H56N4O8 — CID 69324402
4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid (PubChem CID 69324402) has the molecular formula C30H56N4O8 and a molecular weight of 600.80 g/mol. Its IUPAC name is 4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid.
| Compound Name | 4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
|---|---|
| PubChem CID | 69324402 |
| Molecular Formula | C30H56N4O8 |
| Molecular Weight | 600.80 g/mol |
| Exact Mass | 600.41 |
| IUPAC Name | 4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]butanoic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CCCC(=O)O)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C30H56N4O8/c1-28(2,3)40-25(37)21-32-15-13-31(12-10-11-24(35)36)14-16-33(22-26(38)41-29(4,5)6)18-20-34(19-17-32)23-27(39)42-30(7,8)9/h10-23H2,1-9H3,(H,35,36) |
| InChIKey | CZZXZAHFJGWDCD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.80 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|