C28H52N4O8 — CID 118372049
2-[4,7-bis(3-formyloxy-3-methylbutyl)-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 118372049) has the molecular formula C28H52N4O8 and a molecular weight of 572.74 g/mol. Its IUPAC name is 2-[4,7-bis(3-formyloxy-3-methylbutyl)-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[4,7-bis(3-formyloxy-3-methylbutyl)-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 118372049 |
| Molecular Formula | C28H52N4O8 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | 2-[4,7-bis(3-formyloxy-3-methylbutyl)-10-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CCC(C)(C)OC=O)CCN(CCC(C)(C)OC=O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C28H52N4O8/c1-26(2,3)40-25(37)21-32-17-15-30(11-9-28(6,7)39-23-34)13-12-29(10-8-27(4,5)38-22-33)14-16-31(18-19-32)20-24(35)36/h22-23H,8-21H2,1-7H3,(H,35,36) |
| InChIKey | XISCWAFGFXPTPD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|