C36H66N4O10 — CID 102596552
6-[(2-methylpropan-2-yl)oxy]-6-oxo-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid (PubChem CID 102596552) has the molecular formula C36H66N4O10 and a molecular weight of 714.94 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxy]-6-oxo-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid.
| Compound Name | 6-[(2-methylpropan-2-yl)oxy]-6-oxo-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 102596552 |
| Molecular Formula | C36H66N4O10 |
| Molecular Weight | 714.94 g/mol |
| Exact Mass | 714.48 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxy]-6-oxo-4-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)CC(CCC(=O)O)N1CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C36H66N4O10/c1-33(2,3)47-29(43)23-27(13-14-28(41)42)40-21-19-38(25-31(45)49-35(7,8)9)17-15-37(24-30(44)48-34(4,5)6)16-18-39(20-22-40)26-32(46)50-36(10,11)12/h27H,13-26H2,1-12H3,(H,41,42) |
| InChIKey | QTUFMDYRSULGJN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 155.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.94 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|