C30H58N4O9 — CID 167713259
tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 167713259) has the molecular formula C30H58N4O9 and a molecular weight of 618.81 g/mol. Its IUPAC name is tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 167713259 |
| Molecular Formula | C30H58N4O9 |
| Molecular Weight | 618.81 g/mol |
| Exact Mass | 618.42 |
| IUPAC Name | tert-butyl 2-[4,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-7-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN([C@H](CO)[C@H](O)CO)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C30H58N4O9/c1-28(2,3)41-25(38)18-31-10-12-32(19-26(39)42-29(4,5)6)14-16-34(23(21-35)24(37)22-36)17-15-33(13-11-31)20-27(40)43-30(7,8)9/h23-24,35-37H,10-22H2,1-9H3/t23-,24-/m1/s1 |
| InChIKey | UXDFIUKCMKIGHT-DNQXCXABSA-N |
| XLogP | -0.05 |
| TPSA | 152.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.81 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|