C18H34N4O9 — CID 157203451
bis(carbon dioxide);2-[4,7-dimethyl-10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 157203451) has the molecular formula C18H34N4O9 and a molecular weight of 450.49 g/mol. Its IUPAC name is bis(carbon dioxide);2-[4,7-dimethyl-10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | bis(carbon dioxide);2-[4,7-dimethyl-10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 157203451 |
| Molecular Formula | C18H34N4O9 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | bis(carbon dioxide);2-[4,7-dimethyl-10-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CN1CCN(C)CCN(C(CO)C(O)CO)CCN(CC(=O)O)CC1.O=C=O.O=C=O |
| InChI | InChI=1S/C16H34N4O5.2CO2/c1-17-3-4-18(2)6-9-20(14(12-21)15(23)13-22)10-8-19(7-5-17)11-16(24)25;2*2-1-3/h14-15,21-23H,3-13H2,1-2H3,(H,24,25);; |
| InChIKey | ARBMDNYQEZLUJK-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 179.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |