C18H37N7O6 — CID 147202874
2-[4,10-bis(2-amino-2-oxoethyl)-7-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide (PubChem CID 147202874) has the molecular formula C18H37N7O6 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-[4,10-bis(2-amino-2-oxoethyl)-7-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide.
| Compound Name | 2-[4,10-bis(2-amino-2-oxoethyl)-7-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
|---|---|
| PubChem CID | 147202874 |
| Molecular Formula | C18H37N7O6 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | 2-[4,10-bis(2-amino-2-oxoethyl)-7-(1,3,4-trihydroxybutan-2-yl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide |
| SMILES | NC(=O)CN1CCN(CC(N)=O)CCN(C(CO)C(O)CO)CCN(CC(N)=O)CC1 |
| InChI | InChI=1S/C18H37N7O6/c19-16(29)9-22-1-3-23(10-17(20)30)5-7-25(14(12-26)15(28)13-27)8-6-24(4-2-22)11-18(21)31/h14-15,26-28H,1-13H2,(H2,19,29)(H2,20,30)(H2,21,31) |
| InChIKey | CDRDWQOZPCIHSV-UHFFFAOYSA-N |
| XLogP | -5.62 |
| TPSA | 202.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | -5.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |