C18H35CaN4O7+ — CID 157187834
calcium;carbon dioxide;2-[7-ethyl-4-methyl-10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 157187834) has the molecular formula C18H35CaN4O7+ and a molecular weight of 459.58 g/mol. Its IUPAC name is calcium;carbon dioxide;2-[7-ethyl-4-methyl-10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | calcium;carbon dioxide;2-[7-ethyl-4-methyl-10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 157187834 |
| Molecular Formula | C18H35CaN4O7+ |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | calcium;carbon dioxide;2-[7-ethyl-4-methyl-10-[(2R,3S)-1,3,4-trihydroxybutan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CCN1CCN(C)CCN(CC(=O)[O-])CCN([C@H](CO)[C@H](O)CO)CC1.O=C=O.[Ca+2] |
| InChI | InChI=1S/C17H36N4O5.CO2.Ca/c1-3-19-6-4-18(2)5-7-20(12-17(25)26)9-11-21(10-8-19)15(13-22)16(24)14-23;2-1-3;/h15-16,22-24H,3-14H2,1-2H3,(H,25,26);;/q;;+2/p-1/t15-,16-;;/m1../s1 |
| InChIKey | CCRDEZWLUFDXDI-UWGSCQAASA-M |
| XLogP | -4.64 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | -4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |